C9H11NNa2O5 — CID 88658660
disodium;(2S)-2-[[(E)-4-oxopent-2-en-2-yl]amino]butanedioate (PubChem CID 88658660) has the molecular formula C9H11NNa2O5 and a molecular weight of 259.17 g/mol. Its IUPAC name is disodium;(2S)-2-[[(E)-4-oxopent-2-en-2-yl]amino]butanedioate.
| Compound Name | disodium;(2S)-2-[[(E)-4-oxopent-2-en-2-yl]amino]butanedioate |
|---|---|
| PubChem CID | 88658660 |
| Molecular Formula | C9H11NNa2O5 |
| Molecular Weight | 259.17 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | disodium;(2S)-2-[[(E)-4-oxopent-2-en-2-yl]amino]butanedioate |
| SMILES | CC(=O)/C=C(\C)N[C@@H](CC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C9H13NO5.2Na/c1-5(3-6(2)11)10-7(9(14)15)4-8(12)13;;/h3,7,10H,4H2,1-2H3,(H,12,13)(H,14,15);;/q;2*+1/p-2/b5-3+;;/t7-;;/m0../s1 |
| InChIKey | HGTJYQJPDOGRGI-FIBSENMISA-L |
| XLogP | -8.66 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.17 |
| LogP ≤ 5 | -8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|