C9H9NO9Tc — CID 76964784
carbon monoxide;(2S)-2-(carboxylatomethylamino)butanedioate;hydron;technetium-99 (PubChem CID 76964784) has the molecular formula C9H9NO9Tc and a molecular weight of 374.08 g/mol. Its IUPAC name is carbon monoxide;(2S)-2-(carboxylatomethylamino)butanedioate;hydron;technetium-99.
| Compound Name | carbon monoxide;(2S)-2-(carboxylatomethylamino)butanedioate;hydron;technetium-99 |
|---|---|
| PubChem CID | 76964784 |
| Molecular Formula | C9H9NO9Tc |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | carbon monoxide;(2S)-2-(carboxylatomethylamino)butanedioate;hydron;technetium-99 |
| SMILES | O=C([O-])CN[C@@H](CC(=O)[O-])C(=O)[O-].[99Tc].[C-]#[O+].[C-]#[O+].[C-]#[O+].[H+].[H+].[H+] |
| InChI | InChI=1S/C6H9NO6.3CO.Tc/c8-4(9)1-3(6(12)13)7-2-5(10)11;3*1-2;/h3,7H,1-2H2,(H,8,9)(H,10,11)(H,12,13);;;;/t3-;;;;/m0..../s1/i;;;;1+1 |
| InChIKey | RRYRFEWBYKSNTQ-HVVJSBGQSA-N |
| XLogP | -5.19 |
| TPSA | 192.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|