C10H18N4Na2O5 — CID 159111471
disodium;4-amino-2-[2-[2-(carboxylatomethylamino)ethylamino]ethylamino]-4-oxobutanoate (PubChem CID 159111471) has the molecular formula C10H18N4Na2O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is disodium;4-amino-2-[2-[2-(carboxylatomethylamino)ethylamino]ethylamino]-4-oxobutanoate.
| Compound Name | disodium;4-amino-2-[2-[2-(carboxylatomethylamino)ethylamino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 159111471 |
| Molecular Formula | C10H18N4Na2O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | disodium;4-amino-2-[2-[2-(carboxylatomethylamino)ethylamino]ethylamino]-4-oxobutanoate |
| SMILES | NC(=O)CC(NCCNCCNCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H20N4O5.2Na/c11-8(15)5-7(10(18)19)14-4-3-12-1-2-13-6-9(16)17;;/h7,12-14H,1-6H2,(H2,11,15)(H,16,17)(H,18,19);;/q;2*+1/p-2 |
| InChIKey | KENYIQLHCBLRSE-UHFFFAOYSA-L |
| XLogP | -11.49 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | -11.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|