C5H8N3O4- — CID 7319306
(2S)-4-amino-2-(carbamoylamino)-4-oxobutanoate (PubChem CID 7319306) has the molecular formula C5H8N3O4- and a molecular weight of 174.14 g/mol. Its IUPAC name is (2S)-4-amino-2-(carbamoylamino)-4-oxobutanoate.
| Compound Name | (2S)-4-amino-2-(carbamoylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7319306 |
| Molecular Formula | C5H8N3O4- |
| Molecular Weight | 174.14 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (2S)-4-amino-2-(carbamoylamino)-4-oxobutanoate |
| SMILES | NC(=O)C[C@H](NC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C5H9N3O4/c6-3(9)1-2(4(10)11)8-5(7)12/h2H,1H2,(H2,6,9)(H,10,11)(H3,7,8,12)/p-1/t2-/m0/s1 |
| InChIKey | PMPZMFJQCCSPGS-REOHCLBHSA-M |
| XLogP | -3.35 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.14 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |