C10H18N4Na2O7 — CID 170987998
disodium;(2S)-2-[(2-carboxy-1-carboxylatoethyl)amino]-5-(diaminomethylideneamino)pentanoate;hydrate (PubChem CID 170987998) has the molecular formula C10H18N4Na2O7 and a molecular weight of 352.26 g/mol. Its IUPAC name is disodium;(2S)-2-[(2-carboxy-1-carboxylatoethyl)amino]-5-(diaminomethylideneamino)pentanoate;hydrate.
| Compound Name | disodium;(2S)-2-[(2-carboxy-1-carboxylatoethyl)amino]-5-(diaminomethylideneamino)pentanoate;hydrate |
|---|---|
| PubChem CID | 170987998 |
| Molecular Formula | C10H18N4Na2O7 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | disodium;(2S)-2-[(2-carboxy-1-carboxylatoethyl)amino]-5-(diaminomethylideneamino)pentanoate;hydrate |
| SMILES | NC(N)=NCCC[C@H](NC(CC(=O)O)C(=O)[O-])C(=O)[O-].O.[Na+].[Na+] |
| InChI | InChI=1S/C10H18N4O6.2Na.H2O/c11-10(12)13-3-1-2-5(8(17)18)14-6(9(19)20)4-7(15)16;;;/h5-6,14H,1-4H2,(H,15,16)(H,17,18)(H,19,20)(H4,11,12,13);;;1H2/q;2*+1;/p-2/t5-,6?;;;/m0.../s1 |
| InChIKey | GFDMSVXZHILBEW-BXLPKDCTSA-L |
| XLogP | -11.48 |
| TPSA | 225.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | -11.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|