C6H13N4NaO2S — CID 175880055
sodium (2S)-5-(diaminomethylideneamino)-2-(sulfanylamino)pentanoate (PubChem CID 175880055) has the molecular formula C6H13N4NaO2S and a molecular weight of 228.25 g/mol. Its IUPAC name is sodium (2S)-5-(diaminomethylideneamino)-2-(sulfanylamino)pentanoate.
| Compound Name | sodium (2S)-5-(diaminomethylideneamino)-2-(sulfanylamino)pentanoate |
|---|---|
| PubChem CID | 175880055 |
| Molecular Formula | C6H13N4NaO2S |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | sodium (2S)-5-(diaminomethylideneamino)-2-(sulfanylamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](NS)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H14N4O2S.Na/c7-6(8)9-3-1-2-4(10-13)5(11)12;/h4,10,13H,1-3H2,(H,11,12)(H4,7,8,9);/q;+1/p-1/t4-;/m0./s1 |
| InChIKey | NIMWUBBNVXKARJ-WCCKRBBISA-M |
| XLogP | -5.40 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|