C6H14N4O2S — CID 91357569
5-(diaminomethylideneamino)-2-hydroxy-N-sulfanylpentanamide (PubChem CID 91357569) has the molecular formula C6H14N4O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-hydroxy-N-sulfanylpentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-hydroxy-N-sulfanylpentanamide |
|---|---|
| PubChem CID | 91357569 |
| Molecular Formula | C6H14N4O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-hydroxy-N-sulfanylpentanamide |
| SMILES | NC(N)=NCCCC(O)C(=O)NS |
| InChI | InChI=1S/C6H14N4O2S/c7-6(8)9-3-1-2-4(11)5(12)10-13/h4,11,13H,1-3H2,(H,10,12)(H4,7,8,9) |
| InChIKey | HAWNFZWWWSAMOB-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|