C6H9NO5Zn — CID 88633119
zinc 2-[carboxylatomethyl(ethyl)amino]-2-hydroxyacetate (PubChem CID 88633119) has the molecular formula C6H9NO5Zn and a molecular weight of 240.53 g/mol. Its IUPAC name is zinc 2-[carboxylatomethyl(ethyl)amino]-2-hydroxyacetate.
| Compound Name | zinc 2-[carboxylatomethyl(ethyl)amino]-2-hydroxyacetate |
|---|---|
| PubChem CID | 88633119 |
| Molecular Formula | C6H9NO5Zn |
| Molecular Weight | 240.53 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | zinc 2-[carboxylatomethyl(ethyl)amino]-2-hydroxyacetate |
| SMILES | CCN(CC(=O)[O-])C(O)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C6H11NO5.Zn/c1-2-7(3-4(8)9)5(10)6(11)12;/h5,10H,2-3H2,1H3,(H,8,9)(H,11,12);/q;+2/p-2 |
| InChIKey | XCWOWJUDIHTDIQ-UHFFFAOYSA-L |
| XLogP | -3.88 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.53 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|