C11H16NO6-3 — CID 176841247
2-[bis(carboxylatomethyl)amino]-4,4-dimethylpentanoate (PubChem CID 176841247) has the molecular formula C11H16NO6-3 and a molecular weight of 258.25 g/mol. Its IUPAC name is 2-[bis(carboxylatomethyl)amino]-4,4-dimethylpentanoate.
| Compound Name | 2-[bis(carboxylatomethyl)amino]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 176841247 |
| Molecular Formula | C11H16NO6-3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2-[bis(carboxylatomethyl)amino]-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)CC(C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3)4-7(10(17)18)12(5-8(13)14)6-9(15)16/h7H,4-6H2,1-3H3,(H,13,14)(H,15,16)(H,17,18)/p-3 |
| InChIKey | UBLCMSJCMKFQBY-UHFFFAOYSA-K |
| XLogP | -3.66 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |