C7H14NO2- — CID 149433644
(2S)-2-amino-4,4-dimethylpentanoate (PubChem CID 149433644) has the molecular formula C7H14NO2- and a molecular weight of 144.19 g/mol. Its IUPAC name is (2S)-2-amino-4,4-dimethylpentanoate.
| Compound Name | (2S)-2-amino-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 149433644 |
| Molecular Formula | C7H14NO2- |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | (2S)-2-amino-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C7H15NO2/c1-7(2,3)4-5(8)6(9)10/h5H,4,8H2,1-3H3,(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | LPBSHGLDBQBSPI-YFKPBYRVSA-M |
| XLogP | -0.50 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |