C9H9CaNNa2O8 — CID 139816713
calcium;disodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate (PubChem CID 139816713) has the molecular formula C9H9CaNNa2O8 and a molecular weight of 345.23 g/mol. Its IUPAC name is calcium;disodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate.
| Compound Name | calcium;disodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate |
|---|---|
| PubChem CID | 139816713 |
| Molecular Formula | C9H9CaNNa2O8 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | calcium;disodium;(2S)-2-[bis(carboxylatomethyl)amino]pentanedioate |
| SMILES | O=C([O-])CC[C@@H](C(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Ca+2].[Na+].[Na+] |
| InChI | InChI=1S/C9H13NO8.Ca.2Na/c11-6(12)2-1-5(9(17)18)10(3-7(13)14)4-8(15)16;;;/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18);;;/q;+2;2*+1/p-4/t5-;;;/m0.../s1 |
| InChIKey | PFMWKVUAWHYQRK-BHRFRFAJSA-J |
| XLogP | -12.94 |
| TPSA | 163.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | -12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |