C7H12N2O5 — CID 122536186
2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propanoic acid (PubChem CID 122536186) has the molecular formula C7H12N2O5 and a molecular weight of 204.18 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propanoic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 122536186 |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C7H12N2O5/c1-4(7(13)14)9(2-5(8)10)3-6(11)12/h4H,2-3H2,1H3,(H2,8,10)(H,11,12)(H,13,14) |
| InChIKey | KCKJVQGNDLMNCQ-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |