C7H11N3O3 — CID 107440314
2-[(2-amino-2-oxoethyl)-(1-cyanoethyl)amino]acetic acid (PubChem CID 107440314) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(1-cyanoethyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(1-cyanoethyl)amino]acetic acid |
|---|---|
| PubChem CID | 107440314 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(1-cyanoethyl)amino]acetic acid |
| SMILES | CC(C#N)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C7H11N3O3/c1-5(2-8)10(3-6(9)11)4-7(12)13/h5H,3-4H2,1H3,(H2,9,11)(H,12,13) |
| InChIKey | HLDGQYONHVNTMG-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |