C9H15NO5 — CID 82329086
2-[2-carboxyethyl(2-oxopropyl)amino]propanoic acid (PubChem CID 82329086) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-[2-carboxyethyl(2-oxopropyl)amino]propanoic acid.
| Compound Name | 2-[2-carboxyethyl(2-oxopropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82329086 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 2-[2-carboxyethyl(2-oxopropyl)amino]propanoic acid |
| SMILES | CC(=O)CN(CCC(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C9H15NO5/c1-6(11)5-10(4-3-8(12)13)7(2)9(14)15/h7H,3-5H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | FTTFQKIZFSXZPG-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |