C7H14NO6P — CID 173088955
(2S)-3-hydroxy-2-[methyl(3-phosphonoprop-2-enyl)amino]propanoic acid (PubChem CID 173088955) has the molecular formula C7H14NO6P and a molecular weight of 239.16 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[methyl(3-phosphonoprop-2-enyl)amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[methyl(3-phosphonoprop-2-enyl)amino]propanoic acid |
|---|---|
| PubChem CID | 173088955 |
| Molecular Formula | C7H14NO6P |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (2S)-3-hydroxy-2-[methyl(3-phosphonoprop-2-enyl)amino]propanoic acid |
| SMILES | CN(CC=CP(=O)(O)O)[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C7H14NO6P/c1-8(6(5-9)7(10)11)3-2-4-15(12,13)14/h2,4,6,9H,3,5H2,1H3,(H,10,11)(H2,12,13,14)/t6-/m0/s1 |
| InChIKey | CVAAMMPYAHNHAL-LURJTMIESA-N |
| XLogP | -0.94 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|