C10H19NO9P2 — CID 173092232
(2S)-2-[bis(3-phosphonoprop-2-enyl)amino]-3-hydroxy-2-methylpropanoic acid (PubChem CID 173092232) has the molecular formula C10H19NO9P2 and a molecular weight of 359.21 g/mol. Its IUPAC name is (2S)-2-[bis(3-phosphonoprop-2-enyl)amino]-3-hydroxy-2-methylpropanoic acid.
| Compound Name | (2S)-2-[bis(3-phosphonoprop-2-enyl)amino]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 173092232 |
| Molecular Formula | C10H19NO9P2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (2S)-2-[bis(3-phosphonoprop-2-enyl)amino]-3-hydroxy-2-methylpropanoic acid |
| SMILES | C[C@](CO)(C(=O)O)N(CC=CP(=O)(O)O)CC=CP(=O)(O)O |
| InChI | InChI=1S/C10H19NO9P2/c1-10(8-12,9(13)14)11(4-2-6-21(15,16)17)5-3-7-22(18,19)20/h2-3,6-7,12H,4-5,8H2,1H3,(H,13,14)(H2,15,16,17)(H2,18,19,20)/t10-/m0/s1 |
| InChIKey | DZQZEDQOBHDTRM-JTQLQIEISA-N |
| XLogP | -0.49 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|