C10H17NO10P2 — CID 173421846
4-[3-carboxyprop-2-enyl(1,1-diphosphonoethyl)amino]but-2-enoic acid (PubChem CID 173421846) has the molecular formula C10H17NO10P2 and a molecular weight of 373.19 g/mol. Its IUPAC name is 4-[3-carboxyprop-2-enyl(1,1-diphosphonoethyl)amino]but-2-enoic acid.
| Compound Name | 4-[3-carboxyprop-2-enyl(1,1-diphosphonoethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 173421846 |
| Molecular Formula | C10H17NO10P2 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 4-[3-carboxyprop-2-enyl(1,1-diphosphonoethyl)amino]but-2-enoic acid |
| SMILES | CC(N(CC=CC(=O)O)CC=CC(=O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H17NO10P2/c1-10(22(16,17)18,23(19,20)21)11(6-2-4-8(12)13)7-3-5-9(14)15/h2-5H,6-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)(H2,19,20,21) |
| InChIKey | NWZLORJCRPCLMB-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 192.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|