C15H23NO2 — CID 57030543
4-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]but-2-enoic acid (PubChem CID 57030543) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]but-2-enoic acid.
| Compound Name | 4-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 57030543 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]but-2-enoic acid |
| SMILES | CCN(CC=CC#CC(C)(C)C)CC=CC(=O)O |
| InChI | InChI=1S/C15H23NO2/c1-5-16(13-9-10-14(17)18)12-8-6-7-11-15(2,3)4/h6,8-10H,5,12-13H2,1-4H3,(H,17,18) |
| InChIKey | BFDHGWXMVUPOEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|