C23H33NO — CID 139847530
(E)-4-[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenyl]-2-methylbut-3-en-2-ol (PubChem CID 139847530) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (E)-4-[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenyl]-2-methylbut-3-en-2-ol.
| Compound Name | (E)-4-[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenyl]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 139847530 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (E)-4-[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenyl]-2-methylbut-3-en-2-ol |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(/C=C/C(C)(C)O)c1 |
| InChI | InChI=1S/C23H33NO/c1-7-24(17-10-8-9-15-22(2,3)4)19-21-13-11-12-20(18-21)14-16-23(5,6)25/h8,10-14,16,18,25H,7,17,19H2,1-6H3/b10-8+,16-14+ |
| InChIKey | FMQMADITVWRFEZ-QBTNJIBQSA-N |
| XLogP | 4.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|