C28H39NOSi — CID 10320682
(E)-N-[[3-[[dimethyl-(3-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine (PubChem CID 10320682) has the molecular formula C28H39NOSi and a molecular weight of 433.71 g/mol. Its IUPAC name is (E)-N-[[3-[[dimethyl-(3-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[[3-[[dimethyl-(3-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 10320682 |
| Molecular Formula | C28H39NOSi |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (E)-N-[[3-[[dimethyl-(3-methylphenyl)silyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(OC[Si](C)(C)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C28H39NOSi/c1-8-29(19-11-9-10-18-28(3,4)5)22-25-15-13-16-26(21-25)30-23-31(6,7)27-17-12-14-24(2)20-27/h9,11-17,20-21H,8,19,22-23H2,1-7H3/b11-9+ |
| InChIKey | RPOZVVKJGZOPKY-PKNBQFBNSA-N |
| XLogP | 5.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|