C27H36BrNOSi — CID 10097424
(E)-N-[[3-[[(4-bromophenyl)-dimethylsilyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine (PubChem CID 10097424) has the molecular formula C27H36BrNOSi and a molecular weight of 498.58 g/mol. Its IUPAC name is (E)-N-[[3-[[(4-bromophenyl)-dimethylsilyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[[3-[[(4-bromophenyl)-dimethylsilyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 10097424 |
| Molecular Formula | C27H36BrNOSi |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | (E)-N-[[3-[[(4-bromophenyl)-dimethylsilyl]methoxy]phenyl]methyl]-N-ethyl-6,6-dimethylhept-2-en-4-yn-1-amine |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(OC[Si](C)(C)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C27H36BrNOSi/c1-7-29(19-10-8-9-18-27(2,3)4)21-23-12-11-13-25(20-23)30-22-31(5,6)26-16-14-24(28)15-17-26/h8,10-17,20H,7,19,21-22H2,1-6H3/b10-8+ |
| InChIKey | IGBLRENREYUMCH-CSKARUKUSA-N |
| XLogP | 6.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|