C28H33N3O — CID 19744678
(E)-N-ethyl-N-[[3-[(3-imidazol-1-ylphenyl)methoxy]phenyl]methyl]-6,6-dimethylhept-2-en-4-yn-1-amine (PubChem CID 19744678) has the molecular formula C28H33N3O and a molecular weight of 427.59 g/mol. Its IUPAC name is (E)-N-ethyl-N-[[3-[(3-imidazol-1-ylphenyl)methoxy]phenyl]methyl]-6,6-dimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-ethyl-N-[[3-[(3-imidazol-1-ylphenyl)methoxy]phenyl]methyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744678 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (E)-N-ethyl-N-[[3-[(3-imidazol-1-ylphenyl)methoxy]phenyl]methyl]-6,6-dimethylhept-2-en-4-yn-1-amine |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(OCc2cccc(-n3ccnc3)c2)c1 |
| InChI | InChI=1S/C28H33N3O/c1-5-30(17-8-6-7-15-28(2,3)4)21-24-11-10-14-27(20-24)32-22-25-12-9-13-26(19-25)31-18-16-29-23-31/h6,8-14,16,18-20,23H,5,17,21-22H2,1-4H3/b8-6+ |
| InChIKey | IADXRRAQPAKCQZ-SOFGYWHQSA-N |
| XLogP | 5.88 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|