C24H28FNO — CID 54016871
N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine (PubChem CID 54016871) has the molecular formula C24H28FNO and a molecular weight of 365.49 g/mol. Its IUPAC name is N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine.
| Compound Name | N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 54016871 |
| Molecular Formula | C24H28FNO |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[[3-[(4-fluorophenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
| SMILES | CN(CC=CC#CC(C)(C)C)Cc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H28FNO/c1-24(2,3)15-6-5-7-16-26(4)18-21-9-8-10-23(17-21)27-19-20-11-13-22(25)14-12-20/h5,7-14,17H,16,18-19H2,1-4H3 |
| InChIKey | KWFWNAYQWWHFTN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|