C25H28N2O — CID 54567158
2-[[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]phenoxy]methyl]benzonitrile (PubChem CID 54567158) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 54567158 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CN(CC=CC#CC(C)(C)C)Cc1cccc(OCc2ccccc2C#N)c1 |
| InChI | InChI=1S/C25H28N2O/c1-25(2,3)15-8-5-9-16-27(4)19-21-11-10-14-24(17-21)28-20-23-13-7-6-12-22(23)18-26/h5-7,9-14,17H,16,19-20H2,1-4H3 |
| InChIKey | ZUQUCSXYFYDGNK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|