C30H33NO — CID 19744834
(E)-N,6,6-trimethyl-N-[[3-[(3-phenylphenyl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine (PubChem CID 19744834) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-N,6,6-trimethyl-N-[[3-[(3-phenylphenyl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine.
| Compound Name | (E)-N,6,6-trimethyl-N-[[3-[(3-phenylphenyl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744834 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (E)-N,6,6-trimethyl-N-[[3-[(3-phenylphenyl)methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc(OCc2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H33NO/c1-30(2,3)19-9-6-10-20-31(4)23-25-13-12-18-29(22-25)32-24-26-14-11-17-28(21-26)27-15-7-5-8-16-27/h5-8,10-18,21-22H,20,23-24H2,1-4H3/b10-6+ |
| InChIKey | RDJIUQKFJKDFJC-UXBLZVDNSA-N |
| XLogP | 6.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|