C23H27NO — CID 86755956
(Z)-N,6,6-trimethyl-N-[(3-phenoxyphenyl)methyl]hept-2-en-4-yn-1-amine (PubChem CID 86755956) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is (Z)-N,6,6-trimethyl-N-[(3-phenoxyphenyl)methyl]hept-2-en-4-yn-1-amine.
| Compound Name | (Z)-N,6,6-trimethyl-N-[(3-phenoxyphenyl)methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 86755956 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (Z)-N,6,6-trimethyl-N-[(3-phenoxyphenyl)methyl]hept-2-en-4-yn-1-amine |
| SMILES | CN(C/C=C\C#CC(C)(C)C)Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H27NO/c1-23(2,3)16-9-6-10-17-24(4)19-20-12-11-15-22(18-20)25-21-13-7-5-8-14-21/h5-8,10-15,18H,17,19H2,1-4H3/b10-6- |
| InChIKey | VHIQRDFVWFQHFG-POHAHGRESA-N |
| XLogP | 5.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|