C21H29N — CID 73447789
N-[(3-but-1-en-2-ylphenyl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine (PubChem CID 73447789) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is N-[(3-but-1-en-2-ylphenyl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine.
| Compound Name | N-[(3-but-1-en-2-ylphenyl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 73447789 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-[(3-but-1-en-2-ylphenyl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
| SMILES | C=C(CC)c1cccc(CN(C)CC=CC#CC(C)(C)C)c1 |
| InChI | InChI=1S/C21H29N/c1-7-18(2)20-13-11-12-19(16-20)17-22(6)15-10-8-9-14-21(3,4)5/h8,10-13,16H,2,7,15,17H2,1,3-6H3 |
| InChIKey | XSGKXMQDAIEERO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|