C20H27N — CID 18333851
(E)-N,6,6-trimethyl-N-[2-(3-methylphenyl)prop-2-enyl]hept-2-en-4-yn-1-amine (PubChem CID 18333851) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is (E)-N,6,6-trimethyl-N-[2-(3-methylphenyl)prop-2-enyl]hept-2-en-4-yn-1-amine.
| Compound Name | (E)-N,6,6-trimethyl-N-[2-(3-methylphenyl)prop-2-enyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 18333851 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (E)-N,6,6-trimethyl-N-[2-(3-methylphenyl)prop-2-enyl]hept-2-en-4-yn-1-amine |
| SMILES | C=C(CN(C)C/C=C/C#CC(C)(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C20H27N/c1-17-11-10-12-19(15-17)18(2)16-21(6)14-9-7-8-13-20(3,4)5/h7,9-12,15H,2,14,16H2,1,3-6H3/b9-7+ |
| InChIKey | UNBBPNCXXWGZHX-VQHVLOKHSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|