C21H31NO — CID 90735293
2-[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]-2-methylphenyl]propan-2-ol (PubChem CID 90735293) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]-2-methylphenyl]propan-2-ol.
| Compound Name | 2-[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]-2-methylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 90735293 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 2-[3-[[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]methyl]-2-methylphenyl]propan-2-ol |
| SMILES | Cc1c(CN(C)CC=CC#CC(C)(C)C)cccc1C(C)(C)O |
| InChI | InChI=1S/C21H31NO/c1-17-18(12-11-13-19(17)21(5,6)23)16-22(7)15-10-8-9-14-20(2,3)4/h8,10-13,23H,15-16H2,1-7H3 |
| InChIKey | BPDHGNKESKXMLR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|