C21H25ClN- — CID 71296891
N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine chloride (PubChem CID 71296891) has the molecular formula C21H25ClN- and a molecular weight of 326.89 g/mol. Its IUPAC name is N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine chloride.
| Compound Name | N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine chloride |
|---|---|
| PubChem CID | 71296891 |
| Molecular Formula | C21H25ClN- |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine chloride |
| SMILES | CN(CC=CC#CC(C)(C)C)Cc1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/p-1 |
| InChIKey | BWMISRWJRUSYEX-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|