C25H29NO4 — CID 170161523
(Z)-but-2-enedioic acid;(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine (PubChem CID 170161523) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 170161523 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (Z)-but-2-enedioic acid;(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H25N.C4H4O4/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;5-3(6)1-2-4(7)8/h5-7,9-14H,16-17H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b9-5+;2-1- |
| InChIKey | YYIQQLATUINCMP-WPIPMVJHSA-N |
| XLogP | 4.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|