About N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide
N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide (PubChem CID 11232393) has the molecular formula C22H26N2
and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide.
Molecular Properties
| Compound Name | N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide |
| PubChem CID | 11232393 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide |
| SMILES | [H]/N=C(\C)N(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H26N2/c1-18(23)24(16-9-5-8-15-22(2,3)4)17-20-13-10-12-19-11-6-7-14-21(19)20/h5-7,9-14,23H,16-17H2,1-4H3/b9-5+,23-18+ |
| InChIKey | OMHDGJZDRDSLIK-SNUKAGJTSA-N |
| XLogP | 5.24 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide?
The IUPAC name of N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide (CID 11232393) is N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide.
What is the SMILES notation for N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide?
The canonical SMILES for N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide is [H]/N=C(\C)N(C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12.
What is the InChIKey of N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide?
The InChIKey is OMHDGJZDRDSLIK-SNUKAGJTSA-N. The full InChI is InChI=1S/C22H26N2/c1-18(23)24(16-9-5-8-15-22(2,3)4)17-20-13-10-12-19-11-6-7-14-21(19)20/h5-7,9-14,23H,16-17H2,1-4H3/b9-5+,23-18+.
What are the key properties of N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide?
N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide has a molecular weight of 318.46 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-6,6-dimethylhept-2-en-4-ynyl]-N-(naphthalen-1-ylmethyl)ethanimidamide is sourced from PubChem (CID 11232393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).