C21H26ClN — CID 11324905
[(E)-6,6-dimethylhept-2-en-4-ynyl]-methyl-(naphthalen-1-ylmethyl)azanium chloride (PubChem CID 11324905) has the molecular formula C21H26ClN and a molecular weight of 327.90 g/mol. Its IUPAC name is [(E)-6,6-dimethylhept-2-en-4-ynyl]-methyl-(naphthalen-1-ylmethyl)azanium chloride.
| Compound Name | [(E)-6,6-dimethylhept-2-en-4-ynyl]-methyl-(naphthalen-1-ylmethyl)azanium chloride |
|---|---|
| PubChem CID | 11324905 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [(E)-6,6-dimethylhept-2-en-4-ynyl]-methyl-(naphthalen-1-ylmethyl)azanium chloride |
| SMILES | C[NH+](C/C=C/C#CC(C)(C)C)Cc1cccc2ccccc12.[Cl-] |
| InChI | InChI=1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/b9-5+; |
| InChIKey | BWMISRWJRUSYEX-SZKNIZGXSA-N |
| XLogP | 0.46 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|