C20H28ClN — CID 73447806
N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride (PubChem CID 73447806) has the molecular formula C20H28ClN and a molecular weight of 317.90 g/mol. Its IUPAC name is N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride.
| Compound Name | N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride |
|---|---|
| PubChem CID | 73447806 |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride |
| SMILES | C=C(C)c1ccccc1CN(C)CC=CC#CC(C)(C)C.Cl |
| InChI | InChI=1S/C20H27N.ClH/c1-17(2)19-13-9-8-12-18(19)16-21(6)15-11-7-10-14-20(3,4)5;/h7-9,11-13H,1,15-16H2,2-6H3;1H |
| InChIKey | QZGZNQZSATXRDS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|