About N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride
N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride (PubChem CID 73447806) has the molecular formula C20H28ClN
and a molecular weight of 317.90 g/mol. Its IUPAC name is N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride |
| PubChem CID | 73447806 |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride |
| SMILES | C=C(C)c1ccccc1CN(C)CC=CC#CC(C)(C)C.Cl |
| InChI | InChI=1S/C20H27N.ClH/c1-17(2)19-13-9-8-12-18(19)16-21(6)15-11-7-10-14-20(3,4)5;/h7-9,11-13H,1,15-16H2,2-6H3;1H |
| InChIKey | QZGZNQZSATXRDS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride?
The IUPAC name of N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride (CID 73447806) is N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride.
What is the SMILES notation for N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride?
The canonical SMILES for N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride is C=C(C)c1ccccc1CN(C)CC=CC#CC(C)(C)C.Cl.
What is the InChIKey of N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride?
The InChIKey is QZGZNQZSATXRDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N.ClH/c1-17(2)19-13-9-8-12-18(19)16-21(6)15-11-7-10-14-20(3,4)5;/h7-9,11-13H,1,15-16H2,2-6H3;1H.
What are the key properties of N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride?
N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride has a molecular weight of 317.90 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,6,6-trimethyl-N-[(2-prop-1-en-2-ylphenyl)methyl]hept-2-en-4-yn-1-amine;hydrochloride is sourced from PubChem (CID 73447806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).