C20H27NO — CID 73430353
N-[2-(2-methoxyphenyl)prop-2-enyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine (PubChem CID 73430353) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[2-(2-methoxyphenyl)prop-2-enyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine.
| Compound Name | N-[2-(2-methoxyphenyl)prop-2-enyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 73430353 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[2-(2-methoxyphenyl)prop-2-enyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
| SMILES | C=C(CN(C)CC=CC#CC(C)(C)C)c1ccccc1OC |
| InChI | InChI=1S/C20H27NO/c1-17(18-12-8-9-13-19(18)22-6)16-21(5)15-11-7-10-14-20(2,3)4/h7-9,11-13H,1,15-16H2,2-6H3 |
| InChIKey | OFULRFIPAVRRDK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|