About 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone
2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone (PubChem CID 18333890) has the molecular formula C19H25NO2
and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone |
| PubChem CID | 18333890 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)CN(C)C/C=C/C#CC(C)(C)C)c1 |
| InChI | InChI=1S/C19H25NO2/c1-19(2,3)12-7-6-8-13-20(4)15-18(21)16-10-9-11-17(14-16)22-5/h6,8-11,14H,13,15H2,1-5H3/b8-6+ |
| InChIKey | IDZPZZHPJNNWGJ-SOFGYWHQSA-N |
| XLogP | 3.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone?
The IUPAC name of 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone (CID 18333890) is 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone.
What is the SMILES notation for 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone?
The canonical SMILES for 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone is COc1cccc(C(=O)CN(C)C/C=C/C#CC(C)(C)C)c1.
What is the InChIKey of 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone?
The InChIKey is IDZPZZHPJNNWGJ-SOFGYWHQSA-N. The full InChI is InChI=1S/C19H25NO2/c1-19(2,3)12-7-6-8-13-20(4)15-18(21)16-10-9-11-17(14-16)22-5/h6,8-11,14H,13,15H2,1-5H3/b8-6+.
What are the key properties of 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone?
2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone has a molecular weight of 299.41 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]-1-(3-methoxyphenyl)ethanone is sourced from PubChem (CID 18333890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).