C24H37NO2Si — CID 173181229
1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]ethanone (PubChem CID 173181229) has the molecular formula C24H37NO2Si and a molecular weight of 399.65 g/mol. Its IUPAC name is 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]ethanone.
| Compound Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]ethanone |
|---|---|
| PubChem CID | 173181229 |
| Molecular Formula | C24H37NO2Si |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[6,6-dimethylhept-2-en-4-ynyl(methyl)amino]ethanone |
| SMILES | CN(CC=CC#CC(C)(C)C)CC(=O)c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H37NO2Si/c1-23(2,3)17-11-10-12-18-25(7)19-22(26)20-13-15-21(16-14-20)27-28(8,9)24(4,5)6/h10,12-16H,18-19H2,1-9H3 |
| InChIKey | FXGYEEGSODFAHK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|