C26H33NO — CID 19744607
(E)-N-[[3-[(2,3-dimethylphenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine (PubChem CID 19744607) has the molecular formula C26H33NO and a molecular weight of 375.56 g/mol. Its IUPAC name is (E)-N-[[3-[(2,3-dimethylphenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[[3-[(2,3-dimethylphenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744607 |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (E)-N-[[3-[(2,3-dimethylphenyl)methoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
| SMILES | Cc1cccc(COc2cccc(CN(C)C/C=C/C#CC(C)(C)C)c2)c1C |
| InChI | InChI=1S/C26H33NO/c1-21-12-10-14-24(22(21)2)20-28-25-15-11-13-23(18-25)19-27(6)17-9-7-8-16-26(3,4)5/h7,9-15,18H,17,19-20H2,1-6H3/b9-7+ |
| InChIKey | BPRCWYYKNYWLKG-VQHVLOKHSA-N |
| XLogP | 5.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|