C27H30N2OS — CID 19744424
(E)-N,6,6-trimethyl-N-[[3-[[3-(1,3-thiazol-2-yl)phenyl]methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine (PubChem CID 19744424) has the molecular formula C27H30N2OS and a molecular weight of 430.62 g/mol. Its IUPAC name is (E)-N,6,6-trimethyl-N-[[3-[[3-(1,3-thiazol-2-yl)phenyl]methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine.
| Compound Name | (E)-N,6,6-trimethyl-N-[[3-[[3-(1,3-thiazol-2-yl)phenyl]methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744424 |
| Molecular Formula | C27H30N2OS |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (E)-N,6,6-trimethyl-N-[[3-[[3-(1,3-thiazol-2-yl)phenyl]methoxy]phenyl]methyl]hept-2-en-4-yn-1-amine |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc(OCc2cccc(-c3nccs3)c2)c1 |
| InChI | InChI=1S/C27H30N2OS/c1-27(2,3)14-6-5-7-16-29(4)20-22-10-9-13-25(19-22)30-21-23-11-8-12-24(18-23)26-28-15-17-31-26/h5,7-13,15,17-19H,16,20-21H2,1-4H3/b7-5+ |
| InChIKey | NRNFJVIVNVZLCD-FNORWQNLSA-N |
| XLogP | 6.43 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|