C22H29NO2 — CID 18333860
ethyl 4-[3-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]prop-1-en-2-yl]benzoate (PubChem CID 18333860) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is ethyl 4-[3-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]prop-1-en-2-yl]benzoate.
| Compound Name | ethyl 4-[3-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]prop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 18333860 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | ethyl 4-[3-[[(E)-6,6-dimethylhept-2-en-4-ynyl]-methylamino]prop-1-en-2-yl]benzoate |
| SMILES | C=C(CN(C)C/C=C/C#CC(C)(C)C)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-7-25-21(24)20-13-11-19(12-14-20)18(2)17-23(6)16-10-8-9-15-22(3,4)5/h8,10-14H,2,7,16-17H2,1,3-6H3/b10-8+ |
| InChIKey | GIQWRVGUCJNRLY-CSKARUKUSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|