C20H27NO2 — CID 86747787
methyl 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]benzoate (PubChem CID 86747787) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is methyl 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]benzoate.
| Compound Name | methyl 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 86747787 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | methyl 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]benzoate |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H27NO2/c1-6-21(14-9-7-8-13-20(2,3)4)16-17-11-10-12-18(15-17)19(22)23-5/h7,9-12,15H,6,14,16H2,1-5H3/b9-7+ |
| InChIKey | CLMHKHUFGSVXLD-VQHVLOKHSA-N |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|