C29H32N2S — CID 54083158
N-ethyl-6,6-dimethyl-N-[[3-[2-[3-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine (PubChem CID 54083158) has the molecular formula C29H32N2S and a molecular weight of 440.66 g/mol. Its IUPAC name is N-ethyl-6,6-dimethyl-N-[[3-[2-[3-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine.
| Compound Name | N-ethyl-6,6-dimethyl-N-[[3-[2-[3-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 54083158 |
| Molecular Formula | C29H32N2S |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-ethyl-6,6-dimethyl-N-[[3-[2-[3-(1,3-thiazol-5-yl)phenyl]ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine |
| SMILES | CCN(CC=CC#CC(C)(C)C)Cc1cccc(C=Cc2cccc(-c3cncs3)c2)c1 |
| InChI | InChI=1S/C29H32N2S/c1-5-31(18-8-6-7-17-29(2,3)4)22-26-13-9-11-24(19-26)15-16-25-12-10-14-27(20-25)28-21-30-23-32-28/h6,8-16,19-21,23H,5,18,22H2,1-4H3 |
| InChIKey | MOOBSGSJTWSNEG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|