C31H36N2 — CID 19744828
(E)-6,6-dimethyl-N-propyl-N-[[3-[(E)-2-(3-pyrrol-1-ylphenyl)ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine (PubChem CID 19744828) has the molecular formula C31H36N2 and a molecular weight of 436.64 g/mol. Its IUPAC name is (E)-6,6-dimethyl-N-propyl-N-[[3-[(E)-2-(3-pyrrol-1-ylphenyl)ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine.
| Compound Name | (E)-6,6-dimethyl-N-propyl-N-[[3-[(E)-2-(3-pyrrol-1-ylphenyl)ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744828 |
| Molecular Formula | C31H36N2 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | (E)-6,6-dimethyl-N-propyl-N-[[3-[(E)-2-(3-pyrrol-1-ylphenyl)ethenyl]phenyl]methyl]hept-2-en-4-yn-1-amine |
| SMILES | CCCN(C/C=C/C#CC(C)(C)C)Cc1cccc(/C=C/c2cccc(-n3cccc3)c2)c1 |
| InChI | InChI=1S/C31H36N2/c1-5-20-32(21-8-6-7-19-31(2,3)4)26-29-15-11-13-27(24-29)17-18-28-14-12-16-30(25-28)33-22-9-10-23-33/h6,8-18,22-25H,5,20-21,26H2,1-4H3/b8-6+,18-17+ |
| InChIKey | DYXGWAWUFWLBQQ-AHZJGFFMSA-N |
| XLogP | 7.47 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|