C28H40N2Si — CID 154489394
3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-N-[2-(2-methylphenyl)propan-2-yl]-N-silylaniline (PubChem CID 154489394) has the molecular formula C28H40N2Si and a molecular weight of 432.73 g/mol. Its IUPAC name is 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-N-[2-(2-methylphenyl)propan-2-yl]-N-silylaniline.
| Compound Name | 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-N-[2-(2-methylphenyl)propan-2-yl]-N-silylaniline |
|---|---|
| PubChem CID | 154489394 |
| Molecular Formula | C28H40N2Si |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-N-[2-(2-methylphenyl)propan-2-yl]-N-silylaniline |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(N([SiH3])C(C)(C)c2ccccc2C)c1 |
| InChI | InChI=1S/C28H40N2Si/c1-8-29(20-13-9-12-19-27(3,4)5)22-24-16-14-17-25(21-24)30(31)28(6,7)26-18-11-10-15-23(26)2/h9-11,13-18,21H,8,20,22H2,1-7,31H3/b13-9+ |
| InChIKey | FYYXCZJXTALUJA-UKTHLTGXSA-N |
| XLogP | 5.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|