C26H30N2O — CID 19744714
3-[[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenoxy]methyl]benzonitrile (PubChem CID 19744714) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 3-[[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 19744714 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 3-[[3-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]phenoxy]methyl]benzonitrile |
| SMILES | CCN(C/C=C/C#CC(C)(C)C)Cc1cccc(OCc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C26H30N2O/c1-5-28(16-8-6-7-15-26(2,3)4)20-23-12-10-14-25(18-23)29-21-24-13-9-11-22(17-24)19-27/h6,8-14,17-18H,5,16,20-21H2,1-4H3/b8-6+ |
| InChIKey | MPZCNUWBBPCFMU-SOFGYWHQSA-N |
| XLogP | 5.56 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|