C27H35NO — CID 19744719
(E)-6,6-dimethyl-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]hept-2-en-4-yn-1-amine (PubChem CID 19744719) has the molecular formula C27H35NO and a molecular weight of 389.58 g/mol. Its IUPAC name is (E)-6,6-dimethyl-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]hept-2-en-4-yn-1-amine.
| Compound Name | (E)-6,6-dimethyl-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]hept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19744719 |
| Molecular Formula | C27H35NO |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (E)-6,6-dimethyl-N-(2-methylpropyl)-N-[(3-phenylmethoxyphenyl)methyl]hept-2-en-4-yn-1-amine |
| SMILES | CC(C)CN(C/C=C/C#CC(C)(C)C)Cc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H35NO/c1-23(2)20-28(18-11-7-10-17-27(3,4)5)21-25-15-12-16-26(19-25)29-22-24-13-8-6-9-14-24/h6-9,11-16,19,23H,18,20-22H2,1-5H3/b11-7+ |
| InChIKey | YNKDDNPUAMPBCN-YRNVUSSQSA-N |
| XLogP | 6.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|