C24H31N3O — CID 19917065
(E)-N-[[3-[(E)-4-imidazol-1-ylbut-2-enoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine (PubChem CID 19917065) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is (E)-N-[[3-[(E)-4-imidazol-1-ylbut-2-enoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine.
| Compound Name | (E)-N-[[3-[(E)-4-imidazol-1-ylbut-2-enoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
|---|---|
| PubChem CID | 19917065 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (E)-N-[[3-[(E)-4-imidazol-1-ylbut-2-enoxy]phenyl]methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine |
| SMILES | CN(C/C=C/C#CC(C)(C)C)Cc1cccc(OC/C=C/Cn2ccnc2)c1 |
| InChI | InChI=1S/C24H31N3O/c1-24(2,3)13-6-5-7-15-26(4)20-22-11-10-12-23(19-22)28-18-9-8-16-27-17-14-25-21-27/h5,7-12,14,17,19,21H,15-16,18,20H2,1-4H3/b7-5+,9-8+ |
| InChIKey | IGBHKNGUIGHFQY-ZIRGRKGMSA-N |
| XLogP | 4.56 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|