About 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide
2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide (PubChem CID 57305398) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide.
Molecular Properties
| Compound Name | 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide |
| PubChem CID | 57305398 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide |
| SMILES | CCN(CC=CC#CC(C)(C)C)CC(=O)NN |
| InChI | InChI=1S/C13H23N3O/c1-5-16(11-12(17)15-14)10-8-6-7-9-13(2,3)4/h6,8H,5,10-11,14H2,1-4H3,(H,15,17) |
| InChIKey | DYDDNEKSNNWKPY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide?
The IUPAC name of 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide (CID 57305398) is 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide.
What is the SMILES notation for 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide?
The canonical SMILES for 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide is CCN(CC=CC#CC(C)(C)C)CC(=O)NN.
What is the InChIKey of 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide?
The InChIKey is DYDDNEKSNNWKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-5-16(11-12(17)15-14)10-8-6-7-9-13(2,3)4/h6,8H,5,10-11,14H2,1-4H3,(H,15,17).
What are the key properties of 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide?
2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide has a molecular weight of 237.35 g/mol, XLogP of 0.90, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide is sourced from PubChem (CID 57305398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).