C13H23N3O — CID 57305398
2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide (PubChem CID 57305398) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide.
| Compound Name | 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 57305398 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]acetohydrazide |
| SMILES | CCN(CC=CC#CC(C)(C)C)CC(=O)NN |
| InChI | InChI=1S/C13H23N3O/c1-5-16(11-12(17)15-14)10-8-6-7-9-13(2,3)4/h6,8H,5,10-11,14H2,1-4H3,(H,15,17) |
| InChIKey | DYDDNEKSNNWKPY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|