C16H30N2O2 — CID 163825180
2-[[(E)-5,5-dimethyl-6-oxohex-2-enyl]-propylamino]-N-propylacetamide (PubChem CID 163825180) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-[[(E)-5,5-dimethyl-6-oxohex-2-enyl]-propylamino]-N-propylacetamide.
| Compound Name | 2-[[(E)-5,5-dimethyl-6-oxohex-2-enyl]-propylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 163825180 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[[(E)-5,5-dimethyl-6-oxohex-2-enyl]-propylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C/C=C/CC(C)(C)C=O)CCC |
| InChI | InChI=1S/C16H30N2O2/c1-5-10-17-15(20)13-18(11-6-2)12-8-7-9-16(3,4)14-19/h7-8,14H,5-6,9-13H2,1-4H3,(H,17,20)/b8-7+ |
| InChIKey | NYWBGXWQHPPHSE-BQYQJAHWSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|