C6H14NO5PS — CID 25153758
(2R)-2-methyl-2-[methyl(phosphonomethyl)amino]-3-sulfanylpropanoic acid (PubChem CID 25153758) has the molecular formula C6H14NO5PS and a molecular weight of 243.22 g/mol. Its IUPAC name is (2R)-2-methyl-2-[methyl(phosphonomethyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-methyl-2-[methyl(phosphonomethyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 25153758 |
| Molecular Formula | C6H14NO5PS |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | (2R)-2-methyl-2-[methyl(phosphonomethyl)amino]-3-sulfanylpropanoic acid |
| SMILES | CN(CP(=O)(O)O)[C@@](C)(CS)C(=O)O |
| InChI | InChI=1S/C6H14NO5PS/c1-6(3-14,5(8)9)7(2)4-13(10,11)12/h14H,3-4H2,1-2H3,(H,8,9)(H2,10,11,12)/t6-/m0/s1 |
| InChIKey | HYVBQDVNMLLMKF-LURJTMIESA-N |
| XLogP | -0.17 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|